What is "glyceric acid"

Glyceric \Gly*cer"ic\, a. (Chem.) Pertaining to, or derived from, glycerin.

Glyceric acid (Chem.), an organic acid, obtained by the partial oxidation of glycerin, as a thick liquid. It is a hydroxyl derivative of propionic acid, and has both acid and alcoholic properties.

n. A colourless syrupy organic compound, CH₂OH.CHOH.COOH, formed by the oxidation of glycerol or glyceraldehyde.

n. a syrupy acid obtained by oxidation of glycerol or glyceraldehyde

Glyceric acid is a natural three-carbon sugar acid. Salts and esters of glyceric acid are known as glycerates.

glycerol after reacting with gym-an oxygen giving reagent (such as KMnO4+H2SO4) produced glyceric acid.

KMnO4+3H2SO4=K2SO4+3H20+5[O] CH2OH-CHOH-CH2OH+[O]=CH2OH-CHOH-COOH+H2O